About ethyl 2-[3,3-bis(5-methoxy-1-prop-2-enylindol-3-yl)-2-oxoindol-1-yl]acetate
ethyl 2-[3,3-bis(5-methoxy-1-prop-2-enylindol-3-yl)-2-oxoindol-1-yl]acetate (PubChem CID 53307697) has the molecular formula C36H35N3O5
and a molecular weight of 589.69 g/mol. Its IUPAC name is ethyl 2-[3,3-bis(5-methoxy-1-prop-2-enylindol-3-yl)-2-oxoindol-1-yl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[3,3-bis(5-methoxy-1-prop-2-enylindol-3-yl)-2-oxoindol-1-yl]acetate |
| PubChem CID | 53307697 |
| Molecular Formula | C36H35N3O5 |
| Molecular Weight | 589.69 g/mol |
| Exact Mass | 589.26 |
| IUPAC Name | ethyl 2-[3,3-bis(5-methoxy-1-prop-2-enylindol-3-yl)-2-oxoindol-1-yl]acetate |
| SMILES | C=CCn1cc(C2(c3cn(CC=C)c4ccc(OC)cc34)C(=O)N(CC(=O)OCC)c3ccccc32)c2cc(OC)ccc21 |
| InChI | InChI=1S/C36H35N3O5/c1-6-17-37-21-29(26-19-24(42-4)13-15-31(26)37)36(30-22-38(18-7-2)32-16-14-25(43-5)20-27(30)32)28-11-9-10-12-33(28)39(35(36)41)23-34(40)44-8-3/h6-7,9-16,19-22H,1-2,8,17-18,23H2,3-5H3 |
| InChIKey | VLOLYUWTAUDXTA-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 74.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 589.69 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[3,3-bis(5-methoxy-1-prop-2-enylindol-3-yl)-2-oxoindol-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[3,3-bis(5-methoxy-1-prop-2-enylindol-3-yl)-2-oxoindol-1-yl]acetate?
The IUPAC name of ethyl 2-[3,3-bis(5-methoxy-1-prop-2-enylindol-3-yl)-2-oxoindol-1-yl]acetate (CID 53307697) is ethyl 2-[3,3-bis(5-methoxy-1-prop-2-enylindol-3-yl)-2-oxoindol-1-yl]acetate.
What is the SMILES notation for ethyl 2-[3,3-bis(5-methoxy-1-prop-2-enylindol-3-yl)-2-oxoindol-1-yl]acetate?
The canonical SMILES for ethyl 2-[3,3-bis(5-methoxy-1-prop-2-enylindol-3-yl)-2-oxoindol-1-yl]acetate is C=CCn1cc(C2(c3cn(CC=C)c4ccc(OC)cc34)C(=O)N(CC(=O)OCC)c3ccccc32)c2cc(OC)ccc21.
What is the InChIKey of ethyl 2-[3,3-bis(5-methoxy-1-prop-2-enylindol-3-yl)-2-oxoindol-1-yl]acetate?
The InChIKey is VLOLYUWTAUDXTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H35N3O5/c1-6-17-37-21-29(26-19-24(42-4)13-15-31(26)37)36(30-22-38(18-7-2)32-16-14-25(43-5)20-27(30)32)28-11-9-10-12-33(28)39(35(36)41)23-34(40)44-8-3/h6-7,9-16,19-22H,1-2,8,17-18,23H2,3-5H3.
What are the key properties of ethyl 2-[3,3-bis(5-methoxy-1-prop-2-enylindol-3-yl)-2-oxoindol-1-yl]acetate?
ethyl 2-[3,3-bis(5-methoxy-1-prop-2-enylindol-3-yl)-2-oxoindol-1-yl]acetate has a molecular weight of 589.69 g/mol, XLogP of 6.23, 11 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[3,3-bis(5-methoxy-1-prop-2-enylindol-3-yl)-2-oxoindol-1-yl]acetate is sourced from PubChem (CID 53307697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).