C30H31N5O3 — CID 5330770
6-methoxy-18-methyl-3-[3-(4-methylpiperazin-1-yl)propyl]-3,13,18-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17(21),19,22-nonaene-12,14-dione (PubChem CID 5330770) has the molecular formula C30H31N5O3 and a molecular weight of 509.61 g/mol. Its IUPAC name is 6-methoxy-18-methyl-3-[3-(4-methylpiperazin-1-yl)propyl]-3,13,18-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17(21),19,22-nonaene-12,14-dione.
| Compound Name | 6-methoxy-18-methyl-3-[3-(4-methylpiperazin-1-yl)propyl]-3,13,18-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17(21),19,22-nonaene-12,14-dione |
|---|---|
| PubChem CID | 5330770 |
| Molecular Formula | C30H31N5O3 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.24 |
| IUPAC Name | 6-methoxy-18-methyl-3-[3-(4-methylpiperazin-1-yl)propyl]-3,13,18-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17(21),19,22-nonaene-12,14-dione |
| SMILES | COc1ccc2c3c4c(c5c(ccc6ccn(C)c65)c3n(CCCN3CCN(C)CC3)c2c1)C(=O)NC4=O |
| InChI | InChI=1S/C30H31N5O3/c1-32-13-15-34(16-14-32)10-4-11-35-22-17-19(38-3)6-8-20(22)23-25-26(30(37)31-29(25)36)24-21(28(23)35)7-5-18-9-12-33(2)27(18)24/h5-9,12,17H,4,10-11,13-16H2,1-3H3,(H,31,36,37) |
| InChIKey | WKUAOHBRCMZTIL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 71.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|