C28H26N4O3 — CID 5330777
5-[2-(4-hydroxypiperidin-1-yl)ethyl]-18-methyl-3,13,18-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4,6,8,11(15),17(21),19,22-nonaene-12,14-dione (PubChem CID 5330777) has the molecular formula C28H26N4O3 and a molecular weight of 466.54 g/mol. Its IUPAC name is 5-[2-(4-hydroxypiperidin-1-yl)ethyl]-18-methyl-3,13,18-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4,6,8,11(15),17(21),19,22-nonaene-12,14-dione.
| Compound Name | 5-[2-(4-hydroxypiperidin-1-yl)ethyl]-18-methyl-3,13,18-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4,6,8,11(15),17(21),19,22-nonaene-12,14-dione |
|---|---|
| PubChem CID | 5330777 |
| Molecular Formula | C28H26N4O3 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | 5-[2-(4-hydroxypiperidin-1-yl)ethyl]-18-methyl-3,13,18-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4,6,8,11(15),17(21),19,22-nonaene-12,14-dione |
| SMILES | Cn1ccc2ccc3c4[nH]c5c(CCN6CCC(O)CC6)cccc5c4c4c(c3c21)C(=O)NC4=O |
| InChI | InChI=1S/C28H26N4O3/c1-31-11-7-16-5-6-19-21(26(16)31)23-22(27(34)30-28(23)35)20-18-4-2-3-15(24(18)29-25(19)20)8-12-32-13-9-17(33)10-14-32/h2-7,11,17,29,33H,8-10,12-14H2,1H3,(H,30,34,35) |
| InChIKey | APALQVMWCDGRJB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 90.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|