About 4-(4-prop-2-ynoxyphenyl)-1,2,4-triazole-3,5-dione
4-(4-prop-2-ynoxyphenyl)-1,2,4-triazole-3,5-dione (PubChem CID 53307779) has the molecular formula C11H7N3O3
and a molecular weight of 229.19 g/mol. Its IUPAC name is 4-(4-prop-2-ynoxyphenyl)-1,2,4-triazole-3,5-dione.
Molecular Properties
| Compound Name | 4-(4-prop-2-ynoxyphenyl)-1,2,4-triazole-3,5-dione |
| PubChem CID | 53307779 |
| Molecular Formula | C11H7N3O3 |
| Molecular Weight | 229.19 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 4-(4-prop-2-ynoxyphenyl)-1,2,4-triazole-3,5-dione |
| SMILES | C#CCOc1ccc(N2C(=O)N=NC2=O)cc1 |
| InChI | InChI=1S/C11H7N3O3/c1-2-7-17-9-5-3-8(4-6-9)14-10(15)12-13-11(14)16/h1,3-6H,7H2 |
| InChIKey | YZGYJOCPDQNZTH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.19 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-prop-2-ynoxyphenyl)-1,2,4-triazole-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-prop-2-ynoxyphenyl)-1,2,4-triazole-3,5-dione?
The IUPAC name of 4-(4-prop-2-ynoxyphenyl)-1,2,4-triazole-3,5-dione (CID 53307779) is 4-(4-prop-2-ynoxyphenyl)-1,2,4-triazole-3,5-dione.
What is the SMILES notation for 4-(4-prop-2-ynoxyphenyl)-1,2,4-triazole-3,5-dione?
The canonical SMILES for 4-(4-prop-2-ynoxyphenyl)-1,2,4-triazole-3,5-dione is C#CCOc1ccc(N2C(=O)N=NC2=O)cc1.
What is the InChIKey of 4-(4-prop-2-ynoxyphenyl)-1,2,4-triazole-3,5-dione?
The InChIKey is YZGYJOCPDQNZTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7N3O3/c1-2-7-17-9-5-3-8(4-6-9)14-10(15)12-13-11(14)16/h1,3-6H,7H2.
What are the key properties of 4-(4-prop-2-ynoxyphenyl)-1,2,4-triazole-3,5-dione?
4-(4-prop-2-ynoxyphenyl)-1,2,4-triazole-3,5-dione has a molecular weight of 229.19 g/mol, XLogP of 2.21, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-prop-2-ynoxyphenyl)-1,2,4-triazole-3,5-dione is sourced from PubChem (CID 53307779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).