C15H14N6O3S — CID 5330789
4-[(5-amino-1-benzoyl-1,2,4-triazol-3-yl)amino]benzenesulfonamide (PubChem CID 5330789) has the molecular formula C15H14N6O3S and a molecular weight of 358.38 g/mol. Its IUPAC name is 4-[(5-amino-1-benzoyl-1,2,4-triazol-3-yl)amino]benzenesulfonamide.
| Compound Name | 4-[(5-amino-1-benzoyl-1,2,4-triazol-3-yl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 5330789 |
| Molecular Formula | C15H14N6O3S |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 4-[(5-amino-1-benzoyl-1,2,4-triazol-3-yl)amino]benzenesulfonamide |
| SMILES | Nc1nc(Nc2ccc(S(N)(=O)=O)cc2)nn1C(=O)c1ccccc1 |
| InChI | InChI=1S/C15H14N6O3S/c16-14-19-15(18-11-6-8-12(9-7-11)25(17,23)24)20-21(14)13(22)10-4-2-1-3-5-10/h1-9H,(H2,17,23,24)(H3,16,18,19,20) |
| InChIKey | PTFAHECOMVRYLS-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 145.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |