C21H12BrN3O3 — CID 5330794
6-bromo-20-methoxy-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-12,14-dione (PubChem CID 5330794) has the molecular formula C21H12BrN3O3 and a molecular weight of 434.25 g/mol. Its IUPAC name is 6-bromo-20-methoxy-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-12,14-dione.
| Compound Name | 6-bromo-20-methoxy-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-12,14-dione |
|---|---|
| PubChem CID | 5330794 |
| Molecular Formula | C21H12BrN3O3 |
| Molecular Weight | 434.25 g/mol |
| Exact Mass | 433.01 |
| IUPAC Name | 6-bromo-20-methoxy-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-12,14-dione |
| SMILES | COc1ccc2c(c1)[nH]c1c3[nH]c4cc(Br)ccc4c3c3c(c21)C(=O)NC3=O |
| InChI | InChI=1S/C21H12BrN3O3/c1-28-9-3-5-11-13(7-9)24-19-15(11)17-16(20(26)25-21(17)27)14-10-4-2-8(22)6-12(10)23-18(14)19/h2-7,23-24H,1H3,(H,25,26,27) |
| InChIKey | JBSMKKXBEWWBIS-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.25 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|