C41H35N5O2 — CID 53308042
4-[2-methyl-4-(2-oxo-9-quinolin-3-ylbenzo[h][1,6]naphthyridin-1-yl)phenyl]-N-(1-methylpiperidin-4-yl)benzamide (PubChem CID 53308042) has the molecular formula C41H35N5O2 and a molecular weight of 629.70 g/mol. Its IUPAC name is 4-[2-methyl-4-(2-oxo-9-quinolin-3-ylbenzo[h][1,6]naphthyridin-1-yl)phenyl]-N-(1-methylpiperidin-4-yl)benzamide.
| Compound Name | 4-[2-methyl-4-(2-oxo-9-quinolin-3-ylbenzo[h][1,6]naphthyridin-1-yl)phenyl]-N-(1-methylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 53308042 |
| Molecular Formula | C41H35N5O2 |
| Molecular Weight | 629.70 g/mol |
| Exact Mass | 629.28 |
| IUPAC Name | 4-[2-methyl-4-(2-oxo-9-quinolin-3-ylbenzo[h][1,6]naphthyridin-1-yl)phenyl]-N-(1-methylpiperidin-4-yl)benzamide |
| SMILES | CC1=C(C=CC(=C1)N2C(=O)C=CC3=CN=C4C=CC(=CC4=C32)C5=CC6=CC=CC=C6N=C5)C7=CC=C(C=C7)C(=O)NC8CCN(CC8)C |
| InChI | InChI=1S/C41H35N5O2/c1-26-21-34(13-14-35(26)27-7-9-28(10-8-27)41(48)44-33-17-19-45(2)20-18-33)46-39(47)16-12-31-24-43-38-15-11-29(23-36(38)40(31)46)32-22-30-5-3-4-6-37(30)42-25-32/h3-16,21-25,33H,17-20H2,1-2H3,(H,44,48) |
| InChIKey | OQNZFXCQVQSQDF-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 78.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | 1160 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.70 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|