About 4-[[6-amino-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]benzoic acid
4-[[6-amino-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]benzoic acid (PubChem CID 5330818) has the molecular formula C19H13F2N3O3
and a molecular weight of 369.33 g/mol. Its IUPAC name is 4-[[6-amino-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]benzoic acid.
Molecular Properties
| Compound Name | 4-[[6-amino-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]benzoic acid |
| PubChem CID | 5330818 |
| Molecular Formula | C19H13F2N3O3 |
| Molecular Weight | 369.33 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 4-[[6-amino-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]benzoic acid |
| SMILES | Nc1nc(Nc2ccc(C(=O)O)cc2)ccc1C(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C19H13F2N3O3/c20-13-2-1-3-14(21)16(13)17(25)12-8-9-15(24-18(12)22)23-11-6-4-10(5-7-11)19(26)27/h1-9H,(H,26,27)(H3,22,23,24) |
| InChIKey | CVSDWWDMOFGSDC-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.33 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[6-amino-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[6-amino-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]benzoic acid?
The IUPAC name of 4-[[6-amino-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]benzoic acid (CID 5330818) is 4-[[6-amino-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]benzoic acid.
What is the SMILES notation for 4-[[6-amino-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]benzoic acid?
The canonical SMILES for 4-[[6-amino-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]benzoic acid is Nc1nc(Nc2ccc(C(=O)O)cc2)ccc1C(=O)c1c(F)cccc1F.
What is the InChIKey of 4-[[6-amino-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]benzoic acid?
The InChIKey is CVSDWWDMOFGSDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13F2N3O3/c20-13-2-1-3-14(21)16(13)17(25)12-8-9-15(24-18(12)22)23-11-6-4-10(5-7-11)19(26)27/h1-9H,(H,26,27)(H3,22,23,24).
What are the key properties of 4-[[6-amino-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]benzoic acid?
4-[[6-amino-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]benzoic acid has a molecular weight of 369.33 g/mol, XLogP of 3.61, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[6-amino-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]benzoic acid is sourced from PubChem (CID 5330818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).