C21H18F3N3O3 — CID 53308183
propyl N-[3-[[4-oxo-1-(3,4,5-trifluorophenyl)pyridazin-3-yl]methyl]phenyl]carbamate (PubChem CID 53308183) has the molecular formula C21H18F3N3O3 and a molecular weight of 417.39 g/mol. Its IUPAC name is propyl N-[3-[[4-oxo-1-(3,4,5-trifluorophenyl)pyridazin-3-yl]methyl]phenyl]carbamate.
| Compound Name | propyl N-[3-[[4-oxo-1-(3,4,5-trifluorophenyl)pyridazin-3-yl]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 53308183 |
| Molecular Formula | C21H18F3N3O3 |
| Molecular Weight | 417.39 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | propyl N-[3-[[4-oxo-1-(3,4,5-trifluorophenyl)pyridazin-3-yl]methyl]phenyl]carbamate |
| SMILES | CCCOC(=O)Nc1cccc(Cc2nn(-c3cc(F)c(F)c(F)c3)ccc2=O)c1 |
| InChI | InChI=1S/C21H18F3N3O3/c1-2-8-30-21(29)25-14-5-3-4-13(9-14)10-18-19(28)6-7-27(26-18)15-11-16(22)20(24)17(23)12-15/h3-7,9,11-12H,2,8,10H2,1H3,(H,25,29) |
| InChIKey | XHYVEKMBDRAMIK-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.39 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|