About N-[2-[[6-amino-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]phenyl]benzamide
N-[2-[[6-amino-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]phenyl]benzamide (PubChem CID 5330822) has the molecular formula C25H18F2N4O2
and a molecular weight of 444.44 g/mol. Its IUPAC name is N-[2-[[6-amino-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]phenyl]benzamide.
Molecular Properties
| Compound Name | N-[2-[[6-amino-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]phenyl]benzamide |
| PubChem CID | 5330822 |
| Molecular Formula | C25H18F2N4O2 |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | N-[2-[[6-amino-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]phenyl]benzamide |
| SMILES | Nc1nc(Nc2ccccc2NC(=O)c2ccccc2)ccc1C(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C25H18F2N4O2/c26-17-9-6-10-18(27)22(17)23(32)16-13-14-21(31-24(16)28)29-19-11-4-5-12-20(19)30-25(33)15-7-2-1-3-8-15/h1-14H,(H,30,33)(H3,28,29,31) |
| InChIKey | PKISURMVDQRZBN-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-[[6-amino-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]phenyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[[6-amino-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]phenyl]benzamide?
The IUPAC name of N-[2-[[6-amino-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]phenyl]benzamide (CID 5330822) is N-[2-[[6-amino-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]phenyl]benzamide.
What is the SMILES notation for N-[2-[[6-amino-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]phenyl]benzamide?
The canonical SMILES for N-[2-[[6-amino-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]phenyl]benzamide is Nc1nc(Nc2ccccc2NC(=O)c2ccccc2)ccc1C(=O)c1c(F)cccc1F.
What is the InChIKey of N-[2-[[6-amino-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]phenyl]benzamide?
The InChIKey is PKISURMVDQRZBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H18F2N4O2/c26-17-9-6-10-18(27)22(17)23(32)16-13-14-21(31-24(16)28)29-19-11-4-5-12-20(19)30-25(33)15-7-2-1-3-8-15/h1-14H,(H,30,33)(H3,28,29,31).
What are the key properties of N-[2-[[6-amino-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]phenyl]benzamide?
N-[2-[[6-amino-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]phenyl]benzamide has a molecular weight of 444.44 g/mol, XLogP of 5.17, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[[6-amino-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]phenyl]benzamide is sourced from PubChem (CID 5330822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).