About propyl N-[3-[[1-(4-bromo-3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamate
propyl N-[3-[[1-(4-bromo-3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamate (PubChem CID 53308254) has the molecular formula C21H18BrF2N3O3
and a molecular weight of 478.29 g/mol. Its IUPAC name is propyl N-[3-[[1-(4-bromo-3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamate.
Molecular Properties
| Compound Name | propyl N-[3-[[1-(4-bromo-3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamate |
| PubChem CID | 53308254 |
| Molecular Formula | C21H18BrF2N3O3 |
| Molecular Weight | 478.29 g/mol |
| Exact Mass | 477.05 |
| IUPAC Name | propyl N-[3-[[1-(4-bromo-3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamate |
| SMILES | CCCOC(=O)Nc1cccc(Cc2nn(-c3cc(F)c(Br)c(F)c3)ccc2=O)c1 |
| InChI | InChI=1S/C21H18BrF2N3O3/c1-2-8-30-21(29)25-14-5-3-4-13(9-14)10-18-19(28)6-7-27(26-18)15-11-16(23)20(22)17(24)12-15/h3-7,9,11-12H,2,8,10H2,1H3,(H,25,29) |
| InChIKey | PSJHWSHVEACZGS-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 478.29 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze propyl N-[3-[[1-(4-bromo-3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl N-[3-[[1-(4-bromo-3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamate?
The IUPAC name of propyl N-[3-[[1-(4-bromo-3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamate (CID 53308254) is propyl N-[3-[[1-(4-bromo-3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamate.
What is the SMILES notation for propyl N-[3-[[1-(4-bromo-3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamate?
The canonical SMILES for propyl N-[3-[[1-(4-bromo-3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamate is CCCOC(=O)Nc1cccc(Cc2nn(-c3cc(F)c(Br)c(F)c3)ccc2=O)c1.
What is the InChIKey of propyl N-[3-[[1-(4-bromo-3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamate?
The InChIKey is PSJHWSHVEACZGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18BrF2N3O3/c1-2-8-30-21(29)25-14-5-3-4-13(9-14)10-18-19(28)6-7-27(26-18)15-11-16(23)20(22)17(24)12-15/h3-7,9,11-12H,2,8,10H2,1H3,(H,25,29).
What are the key properties of propyl N-[3-[[1-(4-bromo-3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamate?
propyl N-[3-[[1-(4-bromo-3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamate has a molecular weight of 478.29 g/mol, XLogP of 4.82, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propyl N-[3-[[1-(4-bromo-3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamate is sourced from PubChem (CID 53308254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).