About N-[4-[[6-amino-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]phenyl]benzenesulfonamide
N-[4-[[6-amino-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]phenyl]benzenesulfonamide (PubChem CID 5330829) has the molecular formula C24H18F2N4O3S
and a molecular weight of 480.50 g/mol. Its IUPAC name is N-[4-[[6-amino-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]phenyl]benzenesulfonamide.
Molecular Properties
| Compound Name | N-[4-[[6-amino-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]phenyl]benzenesulfonamide |
| PubChem CID | 5330829 |
| Molecular Formula | C24H18F2N4O3S |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | N-[4-[[6-amino-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]phenyl]benzenesulfonamide |
| SMILES | Nc1nc(Nc2ccc(NS(=O)(=O)c3ccccc3)cc2)ccc1C(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C24H18F2N4O3S/c25-19-7-4-8-20(26)22(19)23(31)18-13-14-21(29-24(18)27)28-15-9-11-16(12-10-15)30-34(32,33)17-5-2-1-3-6-17/h1-14,30H,(H3,27,28,29) |
| InChIKey | GGKWBLVTSZVDLR-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[4-[[6-amino-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]phenyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[[6-amino-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]phenyl]benzenesulfonamide?
The IUPAC name of N-[4-[[6-amino-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]phenyl]benzenesulfonamide (CID 5330829) is N-[4-[[6-amino-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]phenyl]benzenesulfonamide.
What is the SMILES notation for N-[4-[[6-amino-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]phenyl]benzenesulfonamide?
The canonical SMILES for N-[4-[[6-amino-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]phenyl]benzenesulfonamide is Nc1nc(Nc2ccc(NS(=O)(=O)c3ccccc3)cc2)ccc1C(=O)c1c(F)cccc1F.
What is the InChIKey of N-[4-[[6-amino-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]phenyl]benzenesulfonamide?
The InChIKey is GGKWBLVTSZVDLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18F2N4O3S/c25-19-7-4-8-20(26)22(19)23(31)18-13-14-21(29-24(18)27)28-15-9-11-16(12-10-15)30-34(32,33)17-5-2-1-3-6-17/h1-14,30H,(H3,27,28,29).
What are the key properties of N-[4-[[6-amino-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]phenyl]benzenesulfonamide?
N-[4-[[6-amino-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]phenyl]benzenesulfonamide has a molecular weight of 480.50 g/mol, XLogP of 4.72, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[[6-amino-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]phenyl]benzenesulfonamide is sourced from PubChem (CID 5330829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).