About 2-methylpropyl N-[3-[[1-(3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamate
2-methylpropyl N-[3-[[1-(3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamate (PubChem CID 53308322) has the molecular formula C22H21F2N3O3
and a molecular weight of 413.42 g/mol. Its IUPAC name is 2-methylpropyl N-[3-[[1-(3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamate.
Molecular Properties
| Compound Name | 2-methylpropyl N-[3-[[1-(3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamate |
| PubChem CID | 53308322 |
| Molecular Formula | C22H21F2N3O3 |
| Molecular Weight | 413.42 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 2-methylpropyl N-[3-[[1-(3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamate |
| SMILES | CC(C)COC(=O)Nc1cccc(Cc2nn(-c3cc(F)cc(F)c3)ccc2=O)c1 |
| InChI | InChI=1S/C22H21F2N3O3/c1-14(2)13-30-22(29)25-18-5-3-4-15(8-18)9-20-21(28)6-7-27(26-20)19-11-16(23)10-17(24)12-19/h3-8,10-12,14H,9,13H2,1-2H3,(H,25,29) |
| InChIKey | DHXCGLFSNNFLNF-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.42 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methylpropyl N-[3-[[1-(3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl N-[3-[[1-(3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamate?
The IUPAC name of 2-methylpropyl N-[3-[[1-(3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamate (CID 53308322) is 2-methylpropyl N-[3-[[1-(3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamate.
What is the SMILES notation for 2-methylpropyl N-[3-[[1-(3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamate?
The canonical SMILES for 2-methylpropyl N-[3-[[1-(3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamate is CC(C)COC(=O)Nc1cccc(Cc2nn(-c3cc(F)cc(F)c3)ccc2=O)c1.
What is the InChIKey of 2-methylpropyl N-[3-[[1-(3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamate?
The InChIKey is DHXCGLFSNNFLNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21F2N3O3/c1-14(2)13-30-22(29)25-18-5-3-4-15(8-18)9-20-21(28)6-7-27(26-20)19-11-16(23)10-17(24)12-19/h3-8,10-12,14H,9,13H2,1-2H3,(H,25,29).
What are the key properties of 2-methylpropyl N-[3-[[1-(3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamate?
2-methylpropyl N-[3-[[1-(3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamate has a molecular weight of 413.42 g/mol, XLogP of 4.31, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl N-[3-[[1-(3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]carbamate is sourced from PubChem (CID 53308322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).