About (1-chloro-6-methoxy-3,4-dihydronaphthalen-2-yl) formate
(1-chloro-6-methoxy-3,4-dihydronaphthalen-2-yl) formate (PubChem CID 53308345) has the molecular formula C12H11ClO3
and a molecular weight of 238.67 g/mol. Its IUPAC name is (1-chloro-6-methoxy-3,4-dihydronaphthalen-2-yl) formate.
Molecular Properties
| Compound Name | (1-chloro-6-methoxy-3,4-dihydronaphthalen-2-yl) formate |
| PubChem CID | 53308345 |
| Molecular Formula | C12H11ClO3 |
| Molecular Weight | 238.67 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | (1-chloro-6-methoxy-3,4-dihydronaphthalen-2-yl) formate |
| SMILES | COc1ccc2c(c1)CCC(OC=O)=C2Cl |
| InChI | InChI=1S/C12H11ClO3/c1-15-9-3-4-10-8(6-9)2-5-11(12(10)13)16-7-14/h3-4,6-7H,2,5H2,1H3 |
| InChIKey | DPEIAHVTQZIGMN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.67 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (1-chloro-6-methoxy-3,4-dihydronaphthalen-2-yl) formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-chloro-6-methoxy-3,4-dihydronaphthalen-2-yl) formate?
The IUPAC name of (1-chloro-6-methoxy-3,4-dihydronaphthalen-2-yl) formate (CID 53308345) is (1-chloro-6-methoxy-3,4-dihydronaphthalen-2-yl) formate.
What is the SMILES notation for (1-chloro-6-methoxy-3,4-dihydronaphthalen-2-yl) formate?
The canonical SMILES for (1-chloro-6-methoxy-3,4-dihydronaphthalen-2-yl) formate is COc1ccc2c(c1)CCC(OC=O)=C2Cl.
What is the InChIKey of (1-chloro-6-methoxy-3,4-dihydronaphthalen-2-yl) formate?
The InChIKey is DPEIAHVTQZIGMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11ClO3/c1-15-9-3-4-10-8(6-9)2-5-11(12(10)13)16-7-14/h3-4,6-7H,2,5H2,1H3.
What are the key properties of (1-chloro-6-methoxy-3,4-dihydronaphthalen-2-yl) formate?
(1-chloro-6-methoxy-3,4-dihydronaphthalen-2-yl) formate has a molecular weight of 238.67 g/mol, XLogP of 2.72, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-chloro-6-methoxy-3,4-dihydronaphthalen-2-yl) formate is sourced from PubChem (CID 53308345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).