C24H26F2N4O4S — CID 5330846
4-[[6-amino-4-butoxy-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]-N,N-dimethylbenzenesulfonamide (PubChem CID 5330846) has the molecular formula C24H26F2N4O4S and a molecular weight of 504.56 g/mol. Its IUPAC name is 4-[[6-amino-4-butoxy-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-[[6-amino-4-butoxy-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 5330846 |
| Molecular Formula | C24H26F2N4O4S |
| Molecular Weight | 504.56 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | 4-[[6-amino-4-butoxy-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]-N,N-dimethylbenzenesulfonamide |
| SMILES | CCCCOc1cc(Nc2ccc(S(=O)(=O)N(C)C)cc2)nc(N)c1C(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C24H26F2N4O4S/c1-4-5-13-34-19-14-20(28-15-9-11-16(12-10-15)35(32,33)30(2)3)29-24(27)22(19)23(31)21-17(25)7-6-8-18(21)26/h6-12,14H,4-5,13H2,1-3H3,(H3,27,28,29) |
| InChIKey | CWPZIVZTUUDPOJ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.56 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|