About N-ethoxy-1,1-diphenylmethanamine
N-ethoxy-1,1-diphenylmethanamine (PubChem CID 53308549) has the molecular formula C15H17NO
and a molecular weight of 227.31 g/mol. Its IUPAC name is N-ethoxy-1,1-diphenylmethanamine.
Molecular Properties
| Compound Name | N-ethoxy-1,1-diphenylmethanamine |
| PubChem CID | 53308549 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | N-ethoxy-1,1-diphenylmethanamine |
| SMILES | CCONC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H17NO/c1-2-17-16-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12,15-16H,2H2,1H3 |
| InChIKey | FDDXEFCKQOBDIN-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-ethoxy-1,1-diphenylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethoxy-1,1-diphenylmethanamine?
The IUPAC name of N-ethoxy-1,1-diphenylmethanamine (CID 53308549) is N-ethoxy-1,1-diphenylmethanamine.
What is the SMILES notation for N-ethoxy-1,1-diphenylmethanamine?
The canonical SMILES for N-ethoxy-1,1-diphenylmethanamine is CCONC(c1ccccc1)c1ccccc1.
What is the InChIKey of N-ethoxy-1,1-diphenylmethanamine?
The InChIKey is FDDXEFCKQOBDIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO/c1-2-17-16-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12,15-16H,2H2,1H3.
What are the key properties of N-ethoxy-1,1-diphenylmethanamine?
N-ethoxy-1,1-diphenylmethanamine has a molecular weight of 227.31 g/mol, XLogP of 3.32, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethoxy-1,1-diphenylmethanamine is sourced from PubChem (CID 53308549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).