C29H51NO5 — CID 53308830
(1S,2R,4R,5S,7S,11S,12S,15R,16S)-15-[(2S,3S,4S,5S)-5-ethyl-3,4-dihydroxy-6-methylheptan-2-yl]-4,5-dihydroxy-2,16-dimethyl-9-azatetracyclo[9.7.0.02,7.012,16]octadecan-8-one (PubChem CID 53308830) has the molecular formula C29H51NO5 and a molecular weight of 493.73 g/mol. Its IUPAC name is (1S,2R,4R,5S,7S,11S,12S,15R,16S)-15-[(2S,3S,4S,5S)-5-ethyl-3,4-dihydroxy-6-methylheptan-2-yl]-4,5-dihydroxy-2,16-dimethyl-9-azatetracyclo[9.7.0.02,7.012,16]octadecan-8-one.
| Compound Name | (1S,2R,4R,5S,7S,11S,12S,15R,16S)-15-[(2S,3S,4S,5S)-5-ethyl-3,4-dihydroxy-6-methylheptan-2-yl]-4,5-dihydroxy-2,16-dimethyl-9-azatetracyclo[9.7.0.02,7.012,16]octadecan-8-one |
|---|---|
| PubChem CID | 53308830 |
| Molecular Formula | C29H51NO5 |
| Molecular Weight | 493.73 g/mol |
| Exact Mass | 493.38 |
| IUPAC Name | (1S,2R,4R,5S,7S,11S,12S,15R,16S)-15-[(2S,3S,4S,5S)-5-ethyl-3,4-dihydroxy-6-methylheptan-2-yl]-4,5-dihydroxy-2,16-dimethyl-9-azatetracyclo[9.7.0.02,7.012,16]octadecan-8-one |
| SMILES | CC[C@@H](C(C)C)[C@H](O)[C@@H](O)[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CNC(=O)[C@H]4C[C@H](O)[C@H](O)C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C29H51NO5/c1-7-17(15(2)3)26(34)25(33)16(4)19-8-9-20-18-14-30-27(35)22-12-23(31)24(32)13-29(22,6)21(18)10-11-28(19,20)5/h15-26,31-34H,7-14H2,1-6H3,(H,30,35)/t16-,17-,18-,19+,20-,21-,22+,23-,24+,25-,26-,28+,29+/m0/s1 |
| InChIKey | BHCWMZPRJGMUEN-DNVPGCTHSA-N |
| XLogP | 3.35 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.73 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |