About 7H-benzo[c]carbazol-2-ol
7H-benzo[c]carbazol-2-ol (PubChem CID 5330887) has the molecular formula C16H11NO
and a molecular weight of 233.27 g/mol. Its IUPAC name is 7H-benzo[c]carbazol-2-ol.
Molecular Properties
| Compound Name | 7H-benzo[c]carbazol-2-ol |
| PubChem CID | 5330887 |
| Molecular Formula | C16H11NO |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 7H-benzo[c]carbazol-2-ol |
| SMILES | Oc1ccc2ccc3[nH]c4ccccc4c3c2c1 |
| InChI | InChI=1S/C16H11NO/c18-11-7-5-10-6-8-15-16(13(10)9-11)12-3-1-2-4-14(12)17-15/h1-9,17-18H |
| InChIKey | MBRSVSZCEODPIF-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7H-benzo[c]carbazol-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7H-benzo[c]carbazol-2-ol?
The IUPAC name of 7H-benzo[c]carbazol-2-ol (CID 5330887) is 7H-benzo[c]carbazol-2-ol.
What is the SMILES notation for 7H-benzo[c]carbazol-2-ol?
The canonical SMILES for 7H-benzo[c]carbazol-2-ol is Oc1ccc2ccc3[nH]c4ccccc4c3c2c1.
What is the InChIKey of 7H-benzo[c]carbazol-2-ol?
The InChIKey is MBRSVSZCEODPIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11NO/c18-11-7-5-10-6-8-15-16(13(10)9-11)12-3-1-2-4-14(12)17-15/h1-9,17-18H.
What are the key properties of 7H-benzo[c]carbazol-2-ol?
7H-benzo[c]carbazol-2-ol has a molecular weight of 233.27 g/mol, XLogP of 4.18, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-benzo[c]carbazol-2-ol is sourced from PubChem (CID 5330887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).