C23H20F3NO3S — CID 53308871
(NE)-4-methyl-N-[(2R)-3,3,3-trifluoro-2-phenyl-2-phenylmethoxypropylidene]benzenesulfonamide (PubChem CID 53308871) has the molecular formula C23H20F3NO3S and a molecular weight of 447.48 g/mol. Its IUPAC name is (NE)-4-methyl-N-[(2R)-3,3,3-trifluoro-2-phenyl-2-phenylmethoxypropylidene]benzenesulfonamide.
| Compound Name | (NE)-4-methyl-N-[(2R)-3,3,3-trifluoro-2-phenyl-2-phenylmethoxypropylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 53308871 |
| Molecular Formula | C23H20F3NO3S |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | (NE)-4-methyl-N-[(2R)-3,3,3-trifluoro-2-phenyl-2-phenylmethoxypropylidene]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)/N=C/[C@](OCc2ccccc2)(c2ccccc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H20F3NO3S/c1-18-12-14-21(15-13-18)31(28,29)27-17-22(23(24,25)26,20-10-6-3-7-11-20)30-16-19-8-4-2-5-9-19/h2-15,17H,16H2,1H3/b27-17+/t22-/m0/s1 |
| InChIKey | MJOYVQSOUKXKAW-XDQFAZSOSA-N |
| XLogP | 5.43 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|