C20H12Cl3N3O2 — CID 53308926
3-[[4-[(3,5,6-trichloro-2-pyridinyl)oxy]phenyl]methyl]pyrido[1,2-a]pyrimidin-2-one (PubChem CID 53308926) has the molecular formula C20H12Cl3N3O2 and a molecular weight of 432.69 g/mol. Its IUPAC name is 3-[[4-[(3,5,6-trichloro-2-pyridinyl)oxy]phenyl]methyl]pyrido[1,2-a]pyrimidin-2-one.
| Compound Name | 3-[[4-[(3,5,6-trichloro-2-pyridinyl)oxy]phenyl]methyl]pyrido[1,2-a]pyrimidin-2-one |
|---|---|
| PubChem CID | 53308926 |
| Molecular Formula | C20H12Cl3N3O2 |
| Molecular Weight | 432.69 g/mol |
| Exact Mass | 431.00 |
| IUPAC Name | 3-[[4-[(3,5,6-trichloro-2-pyridinyl)oxy]phenyl]methyl]pyrido[1,2-a]pyrimidin-2-one |
| SMILES | O=c1nc2ccccn2cc1Cc1ccc(Oc2nc(Cl)c(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C20H12Cl3N3O2/c21-15-10-16(22)20(25-18(15)23)28-14-6-4-12(5-7-14)9-13-11-26-8-2-1-3-17(26)24-19(13)27/h1-8,10-11H,9H2 |
| InChIKey | QFPXGYGEZIILLE-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.69 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|