C14H15F3N4O — CID 5330916
N-[4-(tert-butylamino)-2-(trifluoromethyl)quinazolin-6-yl]formamide (PubChem CID 5330916) has the molecular formula C14H15F3N4O and a molecular weight of 312.30 g/mol. Its IUPAC name is N-[4-(tert-butylamino)-2-(trifluoromethyl)quinazolin-6-yl]formamide.
| Compound Name | N-[4-(tert-butylamino)-2-(trifluoromethyl)quinazolin-6-yl]formamide |
|---|---|
| PubChem CID | 5330916 |
| Molecular Formula | C14H15F3N4O |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | N-[4-(tert-butylamino)-2-(trifluoromethyl)quinazolin-6-yl]formamide |
| SMILES | CC(C)(C)Nc1nc(C(F)(F)F)nc2ccc(NC=O)cc12 |
| InChI | InChI=1S/C14H15F3N4O/c1-13(2,3)21-11-9-6-8(18-7-22)4-5-10(9)19-12(20-11)14(15,16)17/h4-7H,1-3H3,(H,18,22)(H,19,20,21) |
| InChIKey | MKMRIXXHCXELKE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|