About N-tert-butyl-2,6-bis(trifluoromethyl)quinazolin-4-amine
N-tert-butyl-2,6-bis(trifluoromethyl)quinazolin-4-amine (PubChem CID 5330917) has the molecular formula C14H13F6N3
and a molecular weight of 337.27 g/mol. Its IUPAC name is N-tert-butyl-2,6-bis(trifluoromethyl)quinazolin-4-amine.
Molecular Properties
| Compound Name | N-tert-butyl-2,6-bis(trifluoromethyl)quinazolin-4-amine |
| PubChem CID | 5330917 |
| Molecular Formula | C14H13F6N3 |
| Molecular Weight | 337.27 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | N-tert-butyl-2,6-bis(trifluoromethyl)quinazolin-4-amine |
| SMILES | CC(C)(C)Nc1nc(C(F)(F)F)nc2ccc(C(F)(F)F)cc12 |
| InChI | InChI=1S/C14H13F6N3/c1-12(2,3)23-10-8-6-7(13(15,16)17)4-5-9(8)21-11(22-10)14(18,19)20/h4-6H,1-3H3,(H,21,22,23) |
| InChIKey | AETVKDYDELIZIP-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.27 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-tert-butyl-2,6-bis(trifluoromethyl)quinazolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-2,6-bis(trifluoromethyl)quinazolin-4-amine?
The IUPAC name of N-tert-butyl-2,6-bis(trifluoromethyl)quinazolin-4-amine (CID 5330917) is N-tert-butyl-2,6-bis(trifluoromethyl)quinazolin-4-amine.
What is the SMILES notation for N-tert-butyl-2,6-bis(trifluoromethyl)quinazolin-4-amine?
The canonical SMILES for N-tert-butyl-2,6-bis(trifluoromethyl)quinazolin-4-amine is CC(C)(C)Nc1nc(C(F)(F)F)nc2ccc(C(F)(F)F)cc12.
What is the InChIKey of N-tert-butyl-2,6-bis(trifluoromethyl)quinazolin-4-amine?
The InChIKey is AETVKDYDELIZIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13F6N3/c1-12(2,3)23-10-8-6-7(13(15,16)17)4-5-9(8)21-11(22-10)14(18,19)20/h4-6H,1-3H3,(H,21,22,23).
What are the key properties of N-tert-butyl-2,6-bis(trifluoromethyl)quinazolin-4-amine?
N-tert-butyl-2,6-bis(trifluoromethyl)quinazolin-4-amine has a molecular weight of 337.27 g/mol, XLogP of 4.88, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-2,6-bis(trifluoromethyl)quinazolin-4-amine is sourced from PubChem (CID 5330917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).