About N-methoxy-N-methyl-1,3-dithiane-2-carboxamide
N-methoxy-N-methyl-1,3-dithiane-2-carboxamide (PubChem CID 53309195) has the molecular formula C7H13NO2S2
and a molecular weight of 207.32 g/mol. Its IUPAC name is N-methoxy-N-methyl-1,3-dithiane-2-carboxamide.
Molecular Properties
| Compound Name | N-methoxy-N-methyl-1,3-dithiane-2-carboxamide |
| PubChem CID | 53309195 |
| Molecular Formula | C7H13NO2S2 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.04 |
| IUPAC Name | N-methoxy-N-methyl-1,3-dithiane-2-carboxamide |
| SMILES | CON(C)C(=O)C1SCCCS1 |
| InChI | InChI=1S/C7H13NO2S2/c1-8(10-2)6(9)7-11-4-3-5-12-7/h7H,3-5H2,1-2H3 |
| InChIKey | VXDUTPJJNASELN-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methoxy-N-methyl-1,3-dithiane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methoxy-N-methyl-1,3-dithiane-2-carboxamide?
The IUPAC name of N-methoxy-N-methyl-1,3-dithiane-2-carboxamide (CID 53309195) is N-methoxy-N-methyl-1,3-dithiane-2-carboxamide.
What is the SMILES notation for N-methoxy-N-methyl-1,3-dithiane-2-carboxamide?
The canonical SMILES for N-methoxy-N-methyl-1,3-dithiane-2-carboxamide is CON(C)C(=O)C1SCCCS1.
What is the InChIKey of N-methoxy-N-methyl-1,3-dithiane-2-carboxamide?
The InChIKey is VXDUTPJJNASELN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2S2/c1-8(10-2)6(9)7-11-4-3-5-12-7/h7H,3-5H2,1-2H3.
What are the key properties of N-methoxy-N-methyl-1,3-dithiane-2-carboxamide?
N-methoxy-N-methyl-1,3-dithiane-2-carboxamide has a molecular weight of 207.32 g/mol, XLogP of 1.20, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methoxy-N-methyl-1,3-dithiane-2-carboxamide is sourced from PubChem (CID 53309195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).