C20H29NO8 — CID 53309444
(2R,4S,5R,6R)-5-acetamido-4-hydroxy-2-(3-phenylpropyl)-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid (PubChem CID 53309444) has the molecular formula C20H29NO8 and a molecular weight of 411.45 g/mol. Its IUPAC name is (2R,4S,5R,6R)-5-acetamido-4-hydroxy-2-(3-phenylpropyl)-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid.
| Compound Name | (2R,4S,5R,6R)-5-acetamido-4-hydroxy-2-(3-phenylpropyl)-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 53309444 |
| Molecular Formula | C20H29NO8 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | (2R,4S,5R,6R)-5-acetamido-4-hydroxy-2-(3-phenylpropyl)-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
| SMILES | CC(=O)N[C@H]1[C@H]([C@H](O)[C@H](O)CO)O[C@@](CCCc2ccccc2)(C(=O)O)C[C@@H]1O |
| InChI | InChI=1S/C20H29NO8/c1-12(23)21-16-14(24)10-20(19(27)28,29-18(16)17(26)15(25)11-22)9-5-8-13-6-3-2-4-7-13/h2-4,6-7,14-18,22,24-26H,5,8-11H2,1H3,(H,21,23)(H,27,28)/t14-,15+,16+,17+,18+,20+/m0/s1 |
| InChIKey | VJHBWKZVYQESOA-UMCYSPNLSA-N |
| XLogP | -0.80 |
| TPSA | 156.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |