About dimethyl 2-(bromomethyl)-5-cyclohexylimino-2-naphthalen-2-ylfuran-3,4-dicarboxylate
dimethyl 2-(bromomethyl)-5-cyclohexylimino-2-naphthalen-2-ylfuran-3,4-dicarboxylate (PubChem CID 53309668) has the molecular formula C25H26BrNO5
and a molecular weight of 500.39 g/mol. Its IUPAC name is dimethyl 2-(bromomethyl)-5-cyclohexylimino-2-naphthalen-2-ylfuran-3,4-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 2-(bromomethyl)-5-cyclohexylimino-2-naphthalen-2-ylfuran-3,4-dicarboxylate |
| PubChem CID | 53309668 |
| Molecular Formula | C25H26BrNO5 |
| Molecular Weight | 500.39 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | dimethyl 2-(bromomethyl)-5-cyclohexylimino-2-naphthalen-2-ylfuran-3,4-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C(CBr)(c2ccc3ccccc3c2)O/C1=N\C1CCCCC1 |
| InChI | InChI=1S/C25H26BrNO5/c1-30-23(28)20-21(24(29)31-2)25(15-26,32-22(20)27-19-10-4-3-5-11-19)18-13-12-16-8-6-7-9-17(16)14-18/h6-9,12-14,19H,3-5,10-11,15H2,1-2H3/b27-22- |
| InChIKey | PLSDBOPWGNBVAV-QYQHSDTDSA-N |
| XLogP | 4.83 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 500.39 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 2-(bromomethyl)-5-cyclohexylimino-2-naphthalen-2-ylfuran-3,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-(bromomethyl)-5-cyclohexylimino-2-naphthalen-2-ylfuran-3,4-dicarboxylate?
The IUPAC name of dimethyl 2-(bromomethyl)-5-cyclohexylimino-2-naphthalen-2-ylfuran-3,4-dicarboxylate (CID 53309668) is dimethyl 2-(bromomethyl)-5-cyclohexylimino-2-naphthalen-2-ylfuran-3,4-dicarboxylate.
What is the SMILES notation for dimethyl 2-(bromomethyl)-5-cyclohexylimino-2-naphthalen-2-ylfuran-3,4-dicarboxylate?
The canonical SMILES for dimethyl 2-(bromomethyl)-5-cyclohexylimino-2-naphthalen-2-ylfuran-3,4-dicarboxylate is COC(=O)C1=C(C(=O)OC)C(CBr)(c2ccc3ccccc3c2)O/C1=N\C1CCCCC1.
What is the InChIKey of dimethyl 2-(bromomethyl)-5-cyclohexylimino-2-naphthalen-2-ylfuran-3,4-dicarboxylate?
The InChIKey is PLSDBOPWGNBVAV-QYQHSDTDSA-N. The full InChI is InChI=1S/C25H26BrNO5/c1-30-23(28)20-21(24(29)31-2)25(15-26,32-22(20)27-19-10-4-3-5-11-19)18-13-12-16-8-6-7-9-17(16)14-18/h6-9,12-14,19H,3-5,10-11,15H2,1-2H3/b27-22-.
What are the key properties of dimethyl 2-(bromomethyl)-5-cyclohexylimino-2-naphthalen-2-ylfuran-3,4-dicarboxylate?
dimethyl 2-(bromomethyl)-5-cyclohexylimino-2-naphthalen-2-ylfuran-3,4-dicarboxylate has a molecular weight of 500.39 g/mol, XLogP of 4.83, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-(bromomethyl)-5-cyclohexylimino-2-naphthalen-2-ylfuran-3,4-dicarboxylate is sourced from PubChem (CID 53309668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).