About diethyl 2-(bromomethyl)-5-cyclohexylimino-2-naphthalen-2-ylfuran-3,4-dicarboxylate
diethyl 2-(bromomethyl)-5-cyclohexylimino-2-naphthalen-2-ylfuran-3,4-dicarboxylate (PubChem CID 53309669) has the molecular formula C27H30BrNO5
and a molecular weight of 528.44 g/mol. Its IUPAC name is diethyl 2-(bromomethyl)-5-cyclohexylimino-2-naphthalen-2-ylfuran-3,4-dicarboxylate.
Molecular Properties
| Compound Name | diethyl 2-(bromomethyl)-5-cyclohexylimino-2-naphthalen-2-ylfuran-3,4-dicarboxylate |
| PubChem CID | 53309669 |
| Molecular Formula | C27H30BrNO5 |
| Molecular Weight | 528.44 g/mol |
| Exact Mass | 527.13 |
| IUPAC Name | diethyl 2-(bromomethyl)-5-cyclohexylimino-2-naphthalen-2-ylfuran-3,4-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)C(CBr)(c2ccc3ccccc3c2)O/C1=N\C1CCCCC1 |
| InChI | InChI=1S/C27H30BrNO5/c1-3-32-25(30)22-23(26(31)33-4-2)27(17-28,34-24(22)29-21-12-6-5-7-13-21)20-15-14-18-10-8-9-11-19(18)16-20/h8-11,14-16,21H,3-7,12-13,17H2,1-2H3/b29-24- |
| InChIKey | DVLJFZGBKCOUEO-OLFWJLLRSA-N |
| XLogP | 5.61 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 528.44 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-(bromomethyl)-5-cyclohexylimino-2-naphthalen-2-ylfuran-3,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-(bromomethyl)-5-cyclohexylimino-2-naphthalen-2-ylfuran-3,4-dicarboxylate?
The IUPAC name of diethyl 2-(bromomethyl)-5-cyclohexylimino-2-naphthalen-2-ylfuran-3,4-dicarboxylate (CID 53309669) is diethyl 2-(bromomethyl)-5-cyclohexylimino-2-naphthalen-2-ylfuran-3,4-dicarboxylate.
What is the SMILES notation for diethyl 2-(bromomethyl)-5-cyclohexylimino-2-naphthalen-2-ylfuran-3,4-dicarboxylate?
The canonical SMILES for diethyl 2-(bromomethyl)-5-cyclohexylimino-2-naphthalen-2-ylfuran-3,4-dicarboxylate is CCOC(=O)C1=C(C(=O)OCC)C(CBr)(c2ccc3ccccc3c2)O/C1=N\C1CCCCC1.
What is the InChIKey of diethyl 2-(bromomethyl)-5-cyclohexylimino-2-naphthalen-2-ylfuran-3,4-dicarboxylate?
The InChIKey is DVLJFZGBKCOUEO-OLFWJLLRSA-N. The full InChI is InChI=1S/C27H30BrNO5/c1-3-32-25(30)22-23(26(31)33-4-2)27(17-28,34-24(22)29-21-12-6-5-7-13-21)20-15-14-18-10-8-9-11-19(18)16-20/h8-11,14-16,21H,3-7,12-13,17H2,1-2H3/b29-24-.
What are the key properties of diethyl 2-(bromomethyl)-5-cyclohexylimino-2-naphthalen-2-ylfuran-3,4-dicarboxylate?
diethyl 2-(bromomethyl)-5-cyclohexylimino-2-naphthalen-2-ylfuran-3,4-dicarboxylate has a molecular weight of 528.44 g/mol, XLogP of 5.61, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-(bromomethyl)-5-cyclohexylimino-2-naphthalen-2-ylfuran-3,4-dicarboxylate is sourced from PubChem (CID 53309669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).