C23H23ClN2O11S — CID 53309693
methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-[(5-chloro-1,3-thiazol-2-yl)carbamoyl]phenoxy]oxane-2-carboxylate (PubChem CID 53309693) has the molecular formula C23H23ClN2O11S and a molecular weight of 570.96 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-[(5-chloro-1,3-thiazol-2-yl)carbamoyl]phenoxy]oxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-[(5-chloro-1,3-thiazol-2-yl)carbamoyl]phenoxy]oxane-2-carboxylate |
|---|---|
| PubChem CID | 53309693 |
| Molecular Formula | C23H23ClN2O11S |
| Molecular Weight | 570.96 g/mol |
| Exact Mass | 570.07 |
| IUPAC Name | methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-[(5-chloro-1,3-thiazol-2-yl)carbamoyl]phenoxy]oxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](Oc2ccccc2C(=O)Nc2ncc(Cl)s2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C23H23ClN2O11S/c1-10(27)33-16-17(34-11(2)28)19(35-12(3)29)22(37-18(16)21(31)32-4)36-14-8-6-5-7-13(14)20(30)26-23-25-9-15(24)38-23/h5-9,16-19,22H,1-4H3,(H,25,26,30)/t16-,17-,18-,19+,22+/m0/s1 |
| InChIKey | ZJVSFRYRJXDOIH-NJCLPOECSA-N |
| XLogP | 2.12 |
| TPSA | 165.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.96 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|