C19H19N2O4S2+ — CID 53309711
3-[2-[(Z)-(3-methyl-1,3-benzoxazol-2-ylidene)methyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonic acid (PubChem CID 53309711) has the molecular formula C19H19N2O4S2+ and a molecular weight of 403.51 g/mol. Its IUPAC name is 3-[2-[(Z)-(3-methyl-1,3-benzoxazol-2-ylidene)methyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonic acid.
| Compound Name | 3-[2-[(Z)-(3-methyl-1,3-benzoxazol-2-ylidene)methyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 53309711 |
| Molecular Formula | C19H19N2O4S2+ |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | 3-[2-[(Z)-(3-methyl-1,3-benzoxazol-2-ylidene)methyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonic acid |
| SMILES | CN1/C(=C/c2sc3ccccc3[n+]2CCCS(=O)(=O)O)Oc2ccccc21 |
| InChI | InChI=1S/C19H18N2O4S2/c1-20-14-7-2-4-9-16(14)25-18(20)13-19-21(11-6-12-27(22,23)24)15-8-3-5-10-17(15)26-19/h2-5,7-10,13H,6,11-12H2,1H3/p+1 |
| InChIKey | AHPYSIGATYXERL-UHFFFAOYSA-O |
| XLogP | 3.29 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|