C37H37F3N2O4S — CID 53309762
9-tert-butyl-6-ethyl-2-(4-methoxyphenyl)-5,11-dimethyl-3-phenylpyrido[4,3-b]carbazol-6-ium;trifluoromethanesulfonate (PubChem CID 53309762) has the molecular formula C37H37F3N2O4S and a molecular weight of 662.77 g/mol. Its IUPAC name is 9-tert-butyl-6-ethyl-2-(4-methoxyphenyl)-5,11-dimethyl-3-phenylpyrido[4,3-b]carbazol-6-ium;trifluoromethanesulfonate.
| Compound Name | 9-tert-butyl-6-ethyl-2-(4-methoxyphenyl)-5,11-dimethyl-3-phenylpyrido[4,3-b]carbazol-6-ium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 53309762 |
| Molecular Formula | C37H37F3N2O4S |
| Molecular Weight | 662.77 g/mol |
| Exact Mass | 662.24 |
| IUPAC Name | 9-tert-butyl-6-ethyl-2-(4-methoxyphenyl)-5,11-dimethyl-3-phenylpyrido[4,3-b]carbazol-6-ium;trifluoromethanesulfonate |
| SMILES | CC[n+]1c2ccc(C(C)(C)C)cc2c2c(C)c3cn(-c4ccc(OC)cc4)c(-c4ccccc4)cc3c(C)c21.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C36H37N2O.CHF3O3S/c1-8-37-32-19-14-26(36(4,5)6)20-30(32)34-23(2)31-22-38(27-15-17-28(39-7)18-16-27)33(25-12-10-9-11-13-25)21-29(31)24(3)35(34)37;2-1(3,4)8(5,6)7/h9-22H,8H2,1-7H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | CSGQPOTWHXPEJI-UHFFFAOYSA-M |
| XLogP | 8.89 |
| TPSA | 75.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.77 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|