C16H15ClN2O8S — CID 53309834
(2S,3S,4S,5R,6S)-6-[2-[(5-chloro-1,3-thiazol-2-yl)carbamoyl]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 53309834) has the molecular formula C16H15ClN2O8S and a molecular weight of 430.82 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-6-[2-[(5-chloro-1,3-thiazol-2-yl)carbamoyl]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R,6S)-6-[2-[(5-chloro-1,3-thiazol-2-yl)carbamoyl]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 53309834 |
| Molecular Formula | C16H15ClN2O8S |
| Molecular Weight | 430.82 g/mol |
| Exact Mass | 430.02 |
| IUPAC Name | (2S,3S,4S,5R,6S)-6-[2-[(5-chloro-1,3-thiazol-2-yl)carbamoyl]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | O=C(Nc1ncc(Cl)s1)c1ccccc1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C16H15ClN2O8S/c17-8-5-18-16(28-8)19-13(23)6-3-1-2-4-7(6)26-15-11(22)9(20)10(21)12(27-15)14(24)25/h1-5,9-12,15,20-22H,(H,24,25)(H,18,19,23)/t9-,10-,11+,12-,15+/m0/s1 |
| InChIKey | WLQPQSRJTASGRX-QKZHPOIUSA-N |
| XLogP | 0.32 |
| TPSA | 158.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.82 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |