C12H8BrClN2O3S — CID 53309837
[2-[(5-bromo-1,3-thiazol-2-yl)carbamoyl]-4-chlorophenyl] acetate (PubChem CID 53309837) has the molecular formula C12H8BrClN2O3S and a molecular weight of 375.63 g/mol. Its IUPAC name is [2-[(5-bromo-1,3-thiazol-2-yl)carbamoyl]-4-chlorophenyl] acetate.
| Compound Name | [2-[(5-bromo-1,3-thiazol-2-yl)carbamoyl]-4-chlorophenyl] acetate |
|---|---|
| PubChem CID | 53309837 |
| Molecular Formula | C12H8BrClN2O3S |
| Molecular Weight | 375.63 g/mol |
| Exact Mass | 373.91 |
| IUPAC Name | [2-[(5-bromo-1,3-thiazol-2-yl)carbamoyl]-4-chlorophenyl] acetate |
| SMILES | CC(=O)Oc1ccc(Cl)cc1C(=O)Nc1ncc(Br)s1 |
| InChI | InChI=1S/C12H8BrClN2O3S/c1-6(17)19-9-3-2-7(14)4-8(9)11(18)16-12-15-5-10(13)20-12/h2-5H,1H3,(H,15,16,18) |
| InChIKey | QBHFUXSHDBJRCK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.63 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|