C21H18N2O3S — CID 53309968
N-(2-oxo-5-phenyl-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-14-yl)methanesulfonamide (PubChem CID 53309968) has the molecular formula C21H18N2O3S and a molecular weight of 378.45 g/mol. Its IUPAC name is N-(2-oxo-5-phenyl-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-14-yl)methanesulfonamide.
| Compound Name | N-(2-oxo-5-phenyl-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-14-yl)methanesulfonamide |
|---|---|
| PubChem CID | 53309968 |
| Molecular Formula | C21H18N2O3S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | N-(2-oxo-5-phenyl-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-14-yl)methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc2c(c1)C(=O)c1cc(-c3ccccc3)cnc1CC2 |
| InChI | InChI=1S/C21H18N2O3S/c1-27(25,26)23-17-9-7-15-8-10-20-19(21(24)18(15)12-17)11-16(13-22-20)14-5-3-2-4-6-14/h2-7,9,11-13,23H,8,10H2,1H3 |
| InChIKey | AJNQYKAUTVNESQ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |