C20H23N3O3S — CID 53310120
N-[5-[butyl(methyl)amino]-2-oxo-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-14-yl]methanesulfonamide (PubChem CID 53310120) has the molecular formula C20H23N3O3S and a molecular weight of 385.49 g/mol. Its IUPAC name is N-[5-[butyl(methyl)amino]-2-oxo-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-14-yl]methanesulfonamide.
| Compound Name | N-[5-[butyl(methyl)amino]-2-oxo-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-14-yl]methanesulfonamide |
|---|---|
| PubChem CID | 53310120 |
| Molecular Formula | C20H23N3O3S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | N-[5-[butyl(methyl)amino]-2-oxo-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-14-yl]methanesulfonamide |
| SMILES | CCCCN(C)c1cnc2ccc3ccc(NS(C)(=O)=O)cc3c(=O)c2c1 |
| InChI | InChI=1S/C20H23N3O3S/c1-4-5-10-23(2)16-12-18-19(21-13-16)9-7-14-6-8-15(22-27(3,25)26)11-17(14)20(18)24/h6-9,11-13,22H,4-5,10H2,1-3H3 |
| InChIKey | DRDZYRKUFMNEGS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |