C24H23N5O3S — CID 53310262
N-[2-oxo-5-(4-pyridin-3-ylpiperazin-1-yl)-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-14-yl]methanesulfonamide (PubChem CID 53310262) has the molecular formula C24H23N5O3S and a molecular weight of 461.55 g/mol. Its IUPAC name is N-[2-oxo-5-(4-pyridin-3-ylpiperazin-1-yl)-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-14-yl]methanesulfonamide.
| Compound Name | N-[2-oxo-5-(4-pyridin-3-ylpiperazin-1-yl)-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-14-yl]methanesulfonamide |
|---|---|
| PubChem CID | 53310262 |
| Molecular Formula | C24H23N5O3S |
| Molecular Weight | 461.55 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | N-[2-oxo-5-(4-pyridin-3-ylpiperazin-1-yl)-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-14-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc2ccc3ncc(N4CCN(c5cccnc5)CC4)cc3c(=O)c2c1 |
| InChI | InChI=1S/C24H23N5O3S/c1-33(31,32)27-18-6-4-17-5-7-23-22(24(30)21(17)13-18)14-20(16-26-23)29-11-9-28(10-12-29)19-3-2-8-25-15-19/h2-8,13-16,27H,9-12H2,1H3 |
| InChIKey | ONJZQISPOVLZPG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.55 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |