C19H16N4O — CID 53310395
14-(methylamino)-5-(1-methylpyrazol-4-yl)-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-one (PubChem CID 53310395) has the molecular formula C19H16N4O and a molecular weight of 316.36 g/mol. Its IUPAC name is 14-(methylamino)-5-(1-methylpyrazol-4-yl)-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-one.
| Compound Name | 14-(methylamino)-5-(1-methylpyrazol-4-yl)-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-one |
|---|---|
| PubChem CID | 53310395 |
| Molecular Formula | C19H16N4O |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 14-(methylamino)-5-(1-methylpyrazol-4-yl)-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-one |
| SMILES | CNc1ccc2ccc3ncc(-c4cnn(C)c4)cc3c(=O)c2c1 |
| InChI | InChI=1S/C19H16N4O/c1-20-15-5-3-12-4-6-18-17(19(24)16(12)8-15)7-13(9-21-18)14-10-22-23(2)11-14/h3-11,20H,1-2H3 |
| InChIKey | BZSFQQJCDIUDJU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |