C24H28N6O3S — CID 53310547
5-[1-[3-(dimethylamino)propyl]pyrazol-4-yl]-14-(dimethylsulfamoylamino)-2-oxo-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene (PubChem CID 53310547) has the molecular formula C24H28N6O3S and a molecular weight of 480.59 g/mol. Its IUPAC name is 5-[1-[3-(dimethylamino)propyl]pyrazol-4-yl]-14-(dimethylsulfamoylamino)-2-oxo-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene.
| Compound Name | 5-[1-[3-(dimethylamino)propyl]pyrazol-4-yl]-14-(dimethylsulfamoylamino)-2-oxo-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene |
|---|---|
| PubChem CID | 53310547 |
| Molecular Formula | C24H28N6O3S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | 5-[1-[3-(dimethylamino)propyl]pyrazol-4-yl]-14-(dimethylsulfamoylamino)-2-oxo-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene |
| SMILES | CN(C)CCCn1cc(-c2cnc3ccc4ccc(NS(=O)(=O)N(C)C)cc4c(=O)c3c2)cn1 |
| InChI | InChI=1S/C24H28N6O3S/c1-28(2)10-5-11-30-16-19(15-26-30)18-12-22-23(25-14-18)9-7-17-6-8-20(13-21(17)24(22)31)27-34(32,33)29(3)4/h6-9,12-16,27H,5,10-11H2,1-4H3 |
| InChIKey | QIESUVSXDMQLDD-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |