C21H20FN5O3S — CID 53310689
14-(dimethylsulfamoylamino)-5-[1-(2-fluoroethyl)pyrazol-4-yl]-2-oxo-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene (PubChem CID 53310689) has the molecular formula C21H20FN5O3S and a molecular weight of 441.49 g/mol. Its IUPAC name is 14-(dimethylsulfamoylamino)-5-[1-(2-fluoroethyl)pyrazol-4-yl]-2-oxo-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene.
| Compound Name | 14-(dimethylsulfamoylamino)-5-[1-(2-fluoroethyl)pyrazol-4-yl]-2-oxo-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene |
|---|---|
| PubChem CID | 53310689 |
| Molecular Formula | C21H20FN5O3S |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 14-(dimethylsulfamoylamino)-5-[1-(2-fluoroethyl)pyrazol-4-yl]-2-oxo-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene |
| SMILES | CN(C)S(=O)(=O)Nc1ccc2ccc3ncc(-c4cnn(CCF)c4)cc3c(=O)c2c1 |
| InChI | InChI=1S/C21H20FN5O3S/c1-26(2)31(29,30)25-17-5-3-14-4-6-20-19(21(28)18(14)10-17)9-15(11-23-20)16-12-24-27(13-16)8-7-22/h3-6,9-13,25H,7-8H2,1-2H3 |
| InChIKey | ILICPPXYSXACBA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |