C20H34O3 — CID 53310755
(2S,4aR,4bS,6aS,8R,10aS,10bR,12aS)-8-(methoxymethoxy)-1,2,3,4,4a,4b,5,6,6a,7,8,9,10,10a,10b,11,12,12a-octadecahydrochrysen-2-ol (PubChem CID 53310755) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is (2S,4aR,4bS,6aS,8R,10aS,10bR,12aS)-8-(methoxymethoxy)-1,2,3,4,4a,4b,5,6,6a,7,8,9,10,10a,10b,11,12,12a-octadecahydrochrysen-2-ol.
| Compound Name | (2S,4aR,4bS,6aS,8R,10aS,10bR,12aS)-8-(methoxymethoxy)-1,2,3,4,4a,4b,5,6,6a,7,8,9,10,10a,10b,11,12,12a-octadecahydrochrysen-2-ol |
|---|---|
| PubChem CID | 53310755 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | (2S,4aR,4bS,6aS,8R,10aS,10bR,12aS)-8-(methoxymethoxy)-1,2,3,4,4a,4b,5,6,6a,7,8,9,10,10a,10b,11,12,12a-octadecahydrochrysen-2-ol |
| SMILES | COCO[C@@H]1CC[C@H]2[C@@H](CC[C@@H]3[C@@H]2CC[C@H]2C[C@@H](O)CC[C@H]23)C1 |
| InChI | InChI=1S/C20H34O3/c1-22-12-23-16-5-9-18-14(11-16)3-7-19-17-8-4-15(21)10-13(17)2-6-20(18)19/h13-21H,2-12H2,1H3/t13-,14-,15-,16+,17+,18-,19-,20+/m0/s1 |
| InChIKey | BQXUFSRUIPFFLI-MNHVPCHLSA-N |
| XLogP | 3.99 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|