C20H27F3Si2 — CID 53310772
trimethyl-[(1E,5E)-1-[4-(trifluoromethyl)phenyl]-5-trimethylsilylhepta-1,5-dien-3-yn-2-yl]silane (PubChem CID 53310772) has the molecular formula C20H27F3Si2 and a molecular weight of 380.60 g/mol. Its IUPAC name is trimethyl-[(1E,5E)-1-[4-(trifluoromethyl)phenyl]-5-trimethylsilylhepta-1,5-dien-3-yn-2-yl]silane.
| Compound Name | trimethyl-[(1E,5E)-1-[4-(trifluoromethyl)phenyl]-5-trimethylsilylhepta-1,5-dien-3-yn-2-yl]silane |
|---|---|
| PubChem CID | 53310772 |
| Molecular Formula | C20H27F3Si2 |
| Molecular Weight | 380.60 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | trimethyl-[(1E,5E)-1-[4-(trifluoromethyl)phenyl]-5-trimethylsilylhepta-1,5-dien-3-yn-2-yl]silane |
| SMILES | C/C=C(\C#C/C(=C\c1ccc(C(F)(F)F)cc1)[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C20H27F3Si2/c1-8-18(24(2,3)4)13-14-19(25(5,6)7)15-16-9-11-17(12-10-16)20(21,22)23/h8-12,15H,1-7H3/b18-8+,19-15+ |
| InChIKey | KAVVMUIREBUNBT-OSJOWCBESA-N |
| XLogP | 6.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.60 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|