C19H17N5O3S — CID 53310827
5-(1-methylpyrazol-4-yl)-14-(methylsulfamoylamino)-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-one (PubChem CID 53310827) has the molecular formula C19H17N5O3S and a molecular weight of 395.44 g/mol. Its IUPAC name is 5-(1-methylpyrazol-4-yl)-14-(methylsulfamoylamino)-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-one.
| Compound Name | 5-(1-methylpyrazol-4-yl)-14-(methylsulfamoylamino)-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-one |
|---|---|
| PubChem CID | 53310827 |
| Molecular Formula | C19H17N5O3S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 5-(1-methylpyrazol-4-yl)-14-(methylsulfamoylamino)-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-one |
| SMILES | CNS(=O)(=O)Nc1ccc2ccc3ncc(-c4cnn(C)c4)cc3c(=O)c2c1 |
| InChI | InChI=1S/C19H17N5O3S/c1-20-28(26,27)23-15-5-3-12-4-6-18-17(19(25)16(12)8-15)7-13(9-21-18)14-10-22-24(2)11-14/h3-11,20,23H,1-2H3 |
| InChIKey | LPDWDIUXYGHQGU-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |