C22H23N5O3S — CID 53310828
14-(diethylsulfamoylamino)-5-(1-methylpyrazol-4-yl)-2-oxo-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene (PubChem CID 53310828) has the molecular formula C22H23N5O3S and a molecular weight of 437.53 g/mol. Its IUPAC name is 14-(diethylsulfamoylamino)-5-(1-methylpyrazol-4-yl)-2-oxo-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene.
| Compound Name | 14-(diethylsulfamoylamino)-5-(1-methylpyrazol-4-yl)-2-oxo-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene |
|---|---|
| PubChem CID | 53310828 |
| Molecular Formula | C22H23N5O3S |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 14-(diethylsulfamoylamino)-5-(1-methylpyrazol-4-yl)-2-oxo-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene |
| SMILES | CCN(CC)S(=O)(=O)Nc1ccc2ccc3ncc(-c4cnn(C)c4)cc3c(=O)c2c1 |
| InChI | InChI=1S/C22H23N5O3S/c1-4-27(5-2)31(29,30)25-18-8-6-15-7-9-21-20(22(28)19(15)11-18)10-16(12-23-21)17-13-24-26(3)14-17/h6-14,25H,4-5H2,1-3H3 |
| InChIKey | AEOVORPOZVUOMW-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |