C16H13N3O5S — CID 5331083
(3Z)-2-oxo-3-[(4-oxo-6,7-dihydro-2H-pyrano[3,4-c]pyrrol-1-yl)methylidene]-1H-indole-5-sulfonamide (PubChem CID 5331083) has the molecular formula C16H13N3O5S and a molecular weight of 359.36 g/mol. Its IUPAC name is (3Z)-2-oxo-3-[(4-oxo-6,7-dihydro-2H-pyrano[3,4-c]pyrrol-1-yl)methylidene]-1H-indole-5-sulfonamide.
| Compound Name | (3Z)-2-oxo-3-[(4-oxo-6,7-dihydro-2H-pyrano[3,4-c]pyrrol-1-yl)methylidene]-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 5331083 |
| Molecular Formula | C16H13N3O5S |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | (3Z)-2-oxo-3-[(4-oxo-6,7-dihydro-2H-pyrano[3,4-c]pyrrol-1-yl)methylidene]-1H-indole-5-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc2c(c1)/C(=C/c1[nH]cc3c1CCOC3=O)C(=O)N2 |
| InChI | InChI=1S/C16H13N3O5S/c17-25(22,23)8-1-2-13-10(5-8)11(15(20)19-13)6-14-9-3-4-24-16(21)12(9)7-18-14/h1-2,5-7,18H,3-4H2,(H,19,20)(H2,17,22,23)/b11-6- |
| InChIKey | HHNLJCDJQYVVOF-WDZFZDKYSA-N |
| XLogP | 0.87 |
| TPSA | 131.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|