About 1-[(Z)-(5-bromo-2-oxo-1H-indol-3-ylidene)methyl]-6,7-dihydro-2H-pyrano[3,4-c]pyrrol-4-one
1-[(Z)-(5-bromo-2-oxo-1H-indol-3-ylidene)methyl]-6,7-dihydro-2H-pyrano[3,4-c]pyrrol-4-one (PubChem CID 5331089) has the molecular formula C16H11BrN2O3
and a molecular weight of 359.18 g/mol. Its IUPAC name is 1-[(Z)-(5-bromo-2-oxo-1H-indol-3-ylidene)methyl]-6,7-dihydro-2H-pyrano[3,4-c]pyrrol-4-one.
Molecular Properties
| Compound Name | 1-[(Z)-(5-bromo-2-oxo-1H-indol-3-ylidene)methyl]-6,7-dihydro-2H-pyrano[3,4-c]pyrrol-4-one |
| PubChem CID | 5331089 |
| Molecular Formula | C16H11BrN2O3 |
| Molecular Weight | 359.18 g/mol |
| Exact Mass | 358.00 |
| IUPAC Name | 1-[(Z)-(5-bromo-2-oxo-1H-indol-3-ylidene)methyl]-6,7-dihydro-2H-pyrano[3,4-c]pyrrol-4-one |
| SMILES | O=C1Nc2ccc(Br)cc2/C1=C/c1[nH]cc2c1CCOC2=O |
| InChI | InChI=1S/C16H11BrN2O3/c17-8-1-2-13-10(5-8)11(15(20)19-13)6-14-9-3-4-22-16(21)12(9)7-18-14/h1-2,5-7,18H,3-4H2,(H,19,20)/b11-6- |
| InChIKey | NRXJRPGNKFISAO-WDZFZDKYSA-N |
| XLogP | 2.98 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.18 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[(Z)-(5-bromo-2-oxo-1H-indol-3-ylidene)methyl]-6,7-dihydro-2H-pyrano[3,4-c]pyrrol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(Z)-(5-bromo-2-oxo-1H-indol-3-ylidene)methyl]-6,7-dihydro-2H-pyrano[3,4-c]pyrrol-4-one?
The IUPAC name of 1-[(Z)-(5-bromo-2-oxo-1H-indol-3-ylidene)methyl]-6,7-dihydro-2H-pyrano[3,4-c]pyrrol-4-one (CID 5331089) is 1-[(Z)-(5-bromo-2-oxo-1H-indol-3-ylidene)methyl]-6,7-dihydro-2H-pyrano[3,4-c]pyrrol-4-one.
What is the SMILES notation for 1-[(Z)-(5-bromo-2-oxo-1H-indol-3-ylidene)methyl]-6,7-dihydro-2H-pyrano[3,4-c]pyrrol-4-one?
The canonical SMILES for 1-[(Z)-(5-bromo-2-oxo-1H-indol-3-ylidene)methyl]-6,7-dihydro-2H-pyrano[3,4-c]pyrrol-4-one is O=C1Nc2ccc(Br)cc2/C1=C/c1[nH]cc2c1CCOC2=O.
What is the InChIKey of 1-[(Z)-(5-bromo-2-oxo-1H-indol-3-ylidene)methyl]-6,7-dihydro-2H-pyrano[3,4-c]pyrrol-4-one?
The InChIKey is NRXJRPGNKFISAO-WDZFZDKYSA-N. The full InChI is InChI=1S/C16H11BrN2O3/c17-8-1-2-13-10(5-8)11(15(20)19-13)6-14-9-3-4-22-16(21)12(9)7-18-14/h1-2,5-7,18H,3-4H2,(H,19,20)/b11-6-.
What are the key properties of 1-[(Z)-(5-bromo-2-oxo-1H-indol-3-ylidene)methyl]-6,7-dihydro-2H-pyrano[3,4-c]pyrrol-4-one?
1-[(Z)-(5-bromo-2-oxo-1H-indol-3-ylidene)methyl]-6,7-dihydro-2H-pyrano[3,4-c]pyrrol-4-one has a molecular weight of 359.18 g/mol, XLogP of 2.98, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(Z)-(5-bromo-2-oxo-1H-indol-3-ylidene)methyl]-6,7-dihydro-2H-pyrano[3,4-c]pyrrol-4-one is sourced from PubChem (CID 5331089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).