C17H14N2O4 — CID 5331093
1-[(Z)-(6-methoxy-2-oxo-1H-indol-3-ylidene)methyl]-6,7-dihydro-2H-pyrano[3,4-c]pyrrol-4-one (PubChem CID 5331093) has the molecular formula C17H14N2O4 and a molecular weight of 310.31 g/mol. Its IUPAC name is 1-[(Z)-(6-methoxy-2-oxo-1H-indol-3-ylidene)methyl]-6,7-dihydro-2H-pyrano[3,4-c]pyrrol-4-one.
| Compound Name | 1-[(Z)-(6-methoxy-2-oxo-1H-indol-3-ylidene)methyl]-6,7-dihydro-2H-pyrano[3,4-c]pyrrol-4-one |
|---|---|
| PubChem CID | 5331093 |
| Molecular Formula | C17H14N2O4 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 1-[(Z)-(6-methoxy-2-oxo-1H-indol-3-ylidene)methyl]-6,7-dihydro-2H-pyrano[3,4-c]pyrrol-4-one |
| SMILES | COc1ccc2c(c1)NC(=O)/C2=C\c1[nH]cc2c1CCOC2=O |
| InChI | InChI=1S/C17H14N2O4/c1-22-9-2-3-10-12(16(20)19-15(10)6-9)7-14-11-4-5-23-17(21)13(11)8-18-14/h2-3,6-8,18H,4-5H2,1H3,(H,19,20)/b12-7- |
| InChIKey | XJGFIPURTFEPNE-GHXNOFRVSA-N |
| XLogP | 2.23 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|