C17H15N3O3 — CID 5331095
1-[(Z)-(5-methoxy-2-oxo-1H-indol-3-ylidene)methyl]-2,5,6,7-tetrahydropyrrolo[3,4-c]pyridin-4-one (PubChem CID 5331095) has the molecular formula C17H15N3O3 and a molecular weight of 309.33 g/mol. Its IUPAC name is 1-[(Z)-(5-methoxy-2-oxo-1H-indol-3-ylidene)methyl]-2,5,6,7-tetrahydropyrrolo[3,4-c]pyridin-4-one.
| Compound Name | 1-[(Z)-(5-methoxy-2-oxo-1H-indol-3-ylidene)methyl]-2,5,6,7-tetrahydropyrrolo[3,4-c]pyridin-4-one |
|---|---|
| PubChem CID | 5331095 |
| Molecular Formula | C17H15N3O3 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 1-[(Z)-(5-methoxy-2-oxo-1H-indol-3-ylidene)methyl]-2,5,6,7-tetrahydropyrrolo[3,4-c]pyridin-4-one |
| SMILES | COc1ccc2c(c1)/C(=C/c1[nH]cc3c1CCNC3=O)C(=O)N2 |
| InChI | InChI=1S/C17H15N3O3/c1-23-9-2-3-14-11(6-9)12(17(22)20-14)7-15-10-4-5-18-16(21)13(10)8-19-15/h2-3,6-8,19H,4-5H2,1H3,(H,18,21)(H,20,22)/b12-7- |
| InChIKey | YMLCUQPWYZHIPJ-GHXNOFRVSA-N |
| XLogP | 1.80 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|