C21H22N4O2 — CID 5331102
1-[(Z)-(2-oxo-4-piperidin-4-yl-1H-indol-3-ylidene)methyl]-2,5,6,7-tetrahydropyrrolo[3,4-c]pyridin-4-one (PubChem CID 5331102) has the molecular formula C21H22N4O2 and a molecular weight of 362.43 g/mol. Its IUPAC name is 1-[(Z)-(2-oxo-4-piperidin-4-yl-1H-indol-3-ylidene)methyl]-2,5,6,7-tetrahydropyrrolo[3,4-c]pyridin-4-one.
| Compound Name | 1-[(Z)-(2-oxo-4-piperidin-4-yl-1H-indol-3-ylidene)methyl]-2,5,6,7-tetrahydropyrrolo[3,4-c]pyridin-4-one |
|---|---|
| PubChem CID | 5331102 |
| Molecular Formula | C21H22N4O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 1-[(Z)-(2-oxo-4-piperidin-4-yl-1H-indol-3-ylidene)methyl]-2,5,6,7-tetrahydropyrrolo[3,4-c]pyridin-4-one |
| SMILES | O=C1Nc2cccc(C3CCNCC3)c2/C1=C/c1[nH]cc2c1CCNC2=O |
| InChI | InChI=1S/C21H22N4O2/c26-20-16-11-24-18(14(16)6-9-23-20)10-15-19-13(12-4-7-22-8-5-12)2-1-3-17(19)25-21(15)27/h1-3,10-12,22,24H,4-9H2,(H,23,26)(H,25,27)/b15-10- |
| InChIKey | ORMCURCBAUGAQD-GDNBJRDFSA-N |
| XLogP | 2.26 |
| TPSA | 86.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|