About N-(9-bromo-7,12-dihydroindolo[3,2-d][1]benzazepin-6-yl)hydroxylamine
N-(9-bromo-7,12-dihydroindolo[3,2-d][1]benzazepin-6-yl)hydroxylamine (PubChem CID 5331114) has the molecular formula C16H12BrN3O
and a molecular weight of 342.20 g/mol. Its IUPAC name is N-(9-bromo-7,12-dihydroindolo[3,2-d][1]benzazepin-6-yl)hydroxylamine.
Molecular Properties
| Compound Name | N-(9-bromo-7,12-dihydroindolo[3,2-d][1]benzazepin-6-yl)hydroxylamine |
| PubChem CID | 5331114 |
| Molecular Formula | C16H12BrN3O |
| Molecular Weight | 342.20 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | N-(9-bromo-7,12-dihydroindolo[3,2-d][1]benzazepin-6-yl)hydroxylamine |
| SMILES | ONC1=Nc2ccccc2-c2[nH]c3ccc(Br)cc3c2C1 |
| InChI | InChI=1S/C16H12BrN3O/c17-9-5-6-14-11(7-9)12-8-15(20-21)18-13-4-2-1-3-10(13)16(12)19-14/h1-7,19,21H,8H2,(H,18,20) |
| InChIKey | AGVIFWRZNWSNSR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 60.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.20 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(9-bromo-7,12-dihydroindolo[3,2-d][1]benzazepin-6-yl)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(9-bromo-7,12-dihydroindolo[3,2-d][1]benzazepin-6-yl)hydroxylamine?
The IUPAC name of N-(9-bromo-7,12-dihydroindolo[3,2-d][1]benzazepin-6-yl)hydroxylamine (CID 5331114) is N-(9-bromo-7,12-dihydroindolo[3,2-d][1]benzazepin-6-yl)hydroxylamine.
What is the SMILES notation for N-(9-bromo-7,12-dihydroindolo[3,2-d][1]benzazepin-6-yl)hydroxylamine?
The canonical SMILES for N-(9-bromo-7,12-dihydroindolo[3,2-d][1]benzazepin-6-yl)hydroxylamine is ONC1=Nc2ccccc2-c2[nH]c3ccc(Br)cc3c2C1.
What is the InChIKey of N-(9-bromo-7,12-dihydroindolo[3,2-d][1]benzazepin-6-yl)hydroxylamine?
The InChIKey is AGVIFWRZNWSNSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12BrN3O/c17-9-5-6-14-11(7-9)12-8-15(20-21)18-13-4-2-1-3-10(13)16(12)19-14/h1-7,19,21H,8H2,(H,18,20).
What are the key properties of N-(9-bromo-7,12-dihydroindolo[3,2-d][1]benzazepin-6-yl)hydroxylamine?
N-(9-bromo-7,12-dihydroindolo[3,2-d][1]benzazepin-6-yl)hydroxylamine has a molecular weight of 342.20 g/mol, XLogP of 4.16, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(9-bromo-7,12-dihydroindolo[3,2-d][1]benzazepin-6-yl)hydroxylamine is sourced from PubChem (CID 5331114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).