About 9-bromo-12-prop-2-enyl-5,7-dihydroindolo[3,2-d][1]benzazepin-6-one
9-bromo-12-prop-2-enyl-5,7-dihydroindolo[3,2-d][1]benzazepin-6-one (PubChem CID 5331124) has the molecular formula C19H15BrN2O
and a molecular weight of 367.25 g/mol. Its IUPAC name is 9-bromo-12-prop-2-enyl-5,7-dihydroindolo[3,2-d][1]benzazepin-6-one.
Molecular Properties
| Compound Name | 9-bromo-12-prop-2-enyl-5,7-dihydroindolo[3,2-d][1]benzazepin-6-one |
| PubChem CID | 5331124 |
| Molecular Formula | C19H15BrN2O |
| Molecular Weight | 367.25 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | 9-bromo-12-prop-2-enyl-5,7-dihydroindolo[3,2-d][1]benzazepin-6-one |
| SMILES | C=CCn1c2c(c3cc(Br)ccc31)CC(=O)Nc1ccccc1-2 |
| InChI | InChI=1S/C19H15BrN2O/c1-2-9-22-17-8-7-12(20)10-14(17)15-11-18(23)21-16-6-4-3-5-13(16)19(15)22/h2-8,10H,1,9,11H2,(H,21,23) |
| InChIKey | GJZCFRVBDYYNIV-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.25 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 9-bromo-12-prop-2-enyl-5,7-dihydroindolo[3,2-d][1]benzazepin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-bromo-12-prop-2-enyl-5,7-dihydroindolo[3,2-d][1]benzazepin-6-one?
The IUPAC name of 9-bromo-12-prop-2-enyl-5,7-dihydroindolo[3,2-d][1]benzazepin-6-one (CID 5331124) is 9-bromo-12-prop-2-enyl-5,7-dihydroindolo[3,2-d][1]benzazepin-6-one.
What is the SMILES notation for 9-bromo-12-prop-2-enyl-5,7-dihydroindolo[3,2-d][1]benzazepin-6-one?
The canonical SMILES for 9-bromo-12-prop-2-enyl-5,7-dihydroindolo[3,2-d][1]benzazepin-6-one is C=CCn1c2c(c3cc(Br)ccc31)CC(=O)Nc1ccccc1-2.
What is the InChIKey of 9-bromo-12-prop-2-enyl-5,7-dihydroindolo[3,2-d][1]benzazepin-6-one?
The InChIKey is GJZCFRVBDYYNIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15BrN2O/c1-2-9-22-17-8-7-12(20)10-14(17)15-11-18(23)21-16-6-4-3-5-13(16)19(15)22/h2-8,10H,1,9,11H2,(H,21,23).
What are the key properties of 9-bromo-12-prop-2-enyl-5,7-dihydroindolo[3,2-d][1]benzazepin-6-one?
9-bromo-12-prop-2-enyl-5,7-dihydroindolo[3,2-d][1]benzazepin-6-one has a molecular weight of 367.25 g/mol, XLogP of 4.75, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-bromo-12-prop-2-enyl-5,7-dihydroindolo[3,2-d][1]benzazepin-6-one is sourced from PubChem (CID 5331124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).