About 5-benzyl-9-bromo-7,12-dihydroindolo[3,2-d][1]benzazepin-6-one
5-benzyl-9-bromo-7,12-dihydroindolo[3,2-d][1]benzazepin-6-one (PubChem CID 5331125) has the molecular formula C23H17BrN2O
and a molecular weight of 417.31 g/mol. Its IUPAC name is 5-benzyl-9-bromo-7,12-dihydroindolo[3,2-d][1]benzazepin-6-one.
Molecular Properties
| Compound Name | 5-benzyl-9-bromo-7,12-dihydroindolo[3,2-d][1]benzazepin-6-one |
| PubChem CID | 5331125 |
| Molecular Formula | C23H17BrN2O |
| Molecular Weight | 417.31 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | 5-benzyl-9-bromo-7,12-dihydroindolo[3,2-d][1]benzazepin-6-one |
| SMILES | O=C1Cc2c([nH]c3ccc(Br)cc23)-c2ccccc2N1Cc1ccccc1 |
| InChI | InChI=1S/C23H17BrN2O/c24-16-10-11-20-18(12-16)19-13-22(27)26(14-15-6-2-1-3-7-15)21-9-5-4-8-17(21)23(19)25-20/h1-12,25H,13-14H2 |
| InChIKey | HMNQLGPAVMICRU-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 417.31 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-benzyl-9-bromo-7,12-dihydroindolo[3,2-d][1]benzazepin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzyl-9-bromo-7,12-dihydroindolo[3,2-d][1]benzazepin-6-one?
The IUPAC name of 5-benzyl-9-bromo-7,12-dihydroindolo[3,2-d][1]benzazepin-6-one (CID 5331125) is 5-benzyl-9-bromo-7,12-dihydroindolo[3,2-d][1]benzazepin-6-one.
What is the SMILES notation for 5-benzyl-9-bromo-7,12-dihydroindolo[3,2-d][1]benzazepin-6-one?
The canonical SMILES for 5-benzyl-9-bromo-7,12-dihydroindolo[3,2-d][1]benzazepin-6-one is O=C1Cc2c([nH]c3ccc(Br)cc23)-c2ccccc2N1Cc1ccccc1.
What is the InChIKey of 5-benzyl-9-bromo-7,12-dihydroindolo[3,2-d][1]benzazepin-6-one?
The InChIKey is HMNQLGPAVMICRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17BrN2O/c24-16-10-11-20-18(12-16)19-13-22(27)26(14-15-6-2-1-3-7-15)21-9-5-4-8-17(21)23(19)25-20/h1-12,25H,13-14H2.
What are the key properties of 5-benzyl-9-bromo-7,12-dihydroindolo[3,2-d][1]benzazepin-6-one?
5-benzyl-9-bromo-7,12-dihydroindolo[3,2-d][1]benzazepin-6-one has a molecular weight of 417.31 g/mol, XLogP of 5.69, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzyl-9-bromo-7,12-dihydroindolo[3,2-d][1]benzazepin-6-one is sourced from PubChem (CID 5331125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).