C24H33F2N3OS — CID 53311278
5-[4-[4-(8,8-difluoro-5,5-dimethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperazin-1-yl]pentan-1-ol (PubChem CID 53311278) has the molecular formula C24H33F2N3OS and a molecular weight of 449.61 g/mol. Its IUPAC name is 5-[4-[4-(8,8-difluoro-5,5-dimethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperazin-1-yl]pentan-1-ol.
| Compound Name | 5-[4-[4-(8,8-difluoro-5,5-dimethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperazin-1-yl]pentan-1-ol |
|---|---|
| PubChem CID | 53311278 |
| Molecular Formula | C24H33F2N3OS |
| Molecular Weight | 449.61 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | 5-[4-[4-(8,8-difluoro-5,5-dimethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperazin-1-yl]pentan-1-ol |
| SMILES | CC1(C)CCC(F)(F)c2cc(-c3csc(N4CCN(CCCCCO)CC4)n3)ccc21 |
| InChI | InChI=1S/C24H33F2N3OS/c1-23(2)8-9-24(25,26)20-16-18(6-7-19(20)23)21-17-31-22(27-21)29-13-11-28(12-14-29)10-4-3-5-15-30/h6-7,16-17,30H,3-5,8-15H2,1-2H3 |
| InChIKey | AFEYJYMEJNAVNT-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.61 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|